C12H18O2 — CID 145140633
4-(1-hydroxy-2-methylpropyl)-2,6-dimethylphenol (PubChem CID 145140633) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-(1-hydroxy-2-methylpropyl)-2,6-dimethylphenol.
| Compound Name | 4-(1-hydroxy-2-methylpropyl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 145140633 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-(1-hydroxy-2-methylpropyl)-2,6-dimethylphenol |
| SMILES | Cc1cc(C(O)C(C)C)cc(C)c1O |
| InChI | InChI=1S/C12H18O2/c1-7(2)11(13)10-5-8(3)12(14)9(4)6-10/h5-7,11,13-14H,1-4H3 |
| InChIKey | FJVWOKDFSRGBKT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |