C12H20ClNO4 — CID 171272057
2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]benzene-1,3,5-triol;hydrochloride (PubChem CID 171272057) has the molecular formula C12H20ClNO4 and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]benzene-1,3,5-triol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]benzene-1,3,5-triol;hydrochloride |
|---|---|
| PubChem CID | 171272057 |
| Molecular Formula | C12H20ClNO4 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]benzene-1,3,5-triol;hydrochloride |
| SMILES | CCC(C)[C@@H](O)[C@@H](N)c1c(O)cc(O)cc1O.Cl |
| InChI | InChI=1S/C12H19NO4.ClH/c1-3-6(2)12(17)11(13)10-8(15)4-7(14)5-9(10)16;/h4-6,11-12,14-17H,3,13H2,1-2H3;1H/t6?,11-,12+;/m0./s1 |
| InChIKey | HPEZLPKVVBEIPY-ZPSGVWKASA-N |
| XLogP | 1.63 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|