C18H31NO — CID 171265016
(1R,2S)-1-amino-5-methyl-1-(2,3,4,5,6-pentamethylphenyl)hexan-2-ol (PubChem CID 171265016) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is (1R,2S)-1-amino-5-methyl-1-(2,3,4,5,6-pentamethylphenyl)hexan-2-ol.
| Compound Name | (1R,2S)-1-amino-5-methyl-1-(2,3,4,5,6-pentamethylphenyl)hexan-2-ol |
|---|---|
| PubChem CID | 171265016 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | (1R,2S)-1-amino-5-methyl-1-(2,3,4,5,6-pentamethylphenyl)hexan-2-ol |
| SMILES | Cc1c(C)c(C)c([C@@H](N)[C@@H](O)CCC(C)C)c(C)c1C |
| InChI | InChI=1S/C18H31NO/c1-10(2)8-9-16(20)18(19)17-14(6)12(4)11(3)13(5)15(17)7/h10,16,18,20H,8-9,19H2,1-7H3/t16-,18-/m0/s1 |
| InChIKey | QOTKCPMONOVBGI-WMZOPIPTSA-N |
| XLogP | 4.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |