C15H25NO — CID 171270667
(1S,2R)-1-amino-1-(2,3,4,5,6-pentamethylphenyl)butan-2-ol (PubChem CID 171270667) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2,3,4,5,6-pentamethylphenyl)butan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2,3,4,5,6-pentamethylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 171270667 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (1S,2R)-1-amino-1-(2,3,4,5,6-pentamethylphenyl)butan-2-ol |
| SMILES | CC[C@@H](O)[C@@H](N)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C15H25NO/c1-7-13(17)15(16)14-11(5)9(3)8(2)10(4)12(14)6/h13,15,17H,7,16H2,1-6H3/t13-,15-/m1/s1 |
| InChIKey | BJNSDGLKXMJBNB-UKRRQHHQSA-N |
| XLogP | 3.00 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |