C6H15NO — CID 640991
(3R,4S)-4-aminohexan-3-ol (PubChem CID 640991) has the molecular formula C6H15NO and a molecular weight of 117.19 g/mol. Its IUPAC name is (3R,4S)-4-aminohexan-3-ol.
| Compound Name | (3R,4S)-4-aminohexan-3-ol |
|---|---|
| PubChem CID | 640991 |
| Molecular Formula | C6H15NO |
| Molecular Weight | 117.19 g/mol |
| Exact Mass | 117.12 |
| IUPAC Name | (3R,4S)-4-aminohexan-3-ol |
| SMILES | CC[C@@H](O)[C@@H](N)CC |
| InChI | InChI=1S/C6H15NO/c1-3-5(7)6(8)4-2/h5-6,8H,3-4,7H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | IOYVGJNAPMXLLT-NTSWFWBYSA-N |
| XLogP | 0.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |