About (E)-3-aminooct-6-en-4-ol
(E)-3-aminooct-6-en-4-ol (PubChem CID 20676249) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is (E)-3-aminooct-6-en-4-ol.
Molecular Properties
| Compound Name | (E)-3-aminooct-6-en-4-ol |
| PubChem CID | 20676249 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (E)-3-aminooct-6-en-4-ol |
| SMILES | C/C=C/CC(O)C(N)CC |
| InChI | InChI=1S/C8H17NO/c1-3-5-6-8(10)7(9)4-2/h3,5,7-8,10H,4,6,9H2,1-2H3/b5-3+ |
| InChIKey | NPVYXSILFVYZRR-HWKANZROSA-N |
| XLogP | 1.05 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-aminooct-6-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-aminooct-6-en-4-ol?
The IUPAC name of (E)-3-aminooct-6-en-4-ol (CID 20676249) is (E)-3-aminooct-6-en-4-ol.
What is the SMILES notation for (E)-3-aminooct-6-en-4-ol?
The canonical SMILES for (E)-3-aminooct-6-en-4-ol is C/C=C/CC(O)C(N)CC.
What is the InChIKey of (E)-3-aminooct-6-en-4-ol?
The InChIKey is NPVYXSILFVYZRR-HWKANZROSA-N. The full InChI is InChI=1S/C8H17NO/c1-3-5-6-8(10)7(9)4-2/h3,5,7-8,10H,4,6,9H2,1-2H3/b5-3+.
What are the key properties of (E)-3-aminooct-6-en-4-ol?
(E)-3-aminooct-6-en-4-ol has a molecular weight of 143.23 g/mol, XLogP of 1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-aminooct-6-en-4-ol is sourced from PubChem (CID 20676249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).