C6H16N2O — CID 149307886
(4S)-1,4-diaminohexan-3-ol (PubChem CID 149307886) has the molecular formula C6H16N2O and a molecular weight of 132.21 g/mol. Its IUPAC name is (4S)-1,4-diaminohexan-3-ol.
| Compound Name | (4S)-1,4-diaminohexan-3-ol |
|---|---|
| PubChem CID | 149307886 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | (4S)-1,4-diaminohexan-3-ol |
| SMILES | CC[C@H](N)C(O)CCN |
| InChI | InChI=1S/C6H16N2O/c1-2-5(8)6(9)3-4-7/h5-6,9H,2-4,7-8H2,1H3/t5-,6?/m0/s1 |
| InChIKey | XYAPDTVCPSZIQO-ZBHICJROSA-N |
| XLogP | -0.57 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |