About (4S)-1,4-diaminohexan-3-ol
(4S)-1,4-diaminohexan-3-ol (PubChem CID 149307886) has the molecular formula C6H16N2O
and a molecular weight of 132.21 g/mol. Its IUPAC name is (4S)-1,4-diaminohexan-3-ol.
Molecular Properties
| Compound Name | (4S)-1,4-diaminohexan-3-ol |
| PubChem CID | 149307886 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | (4S)-1,4-diaminohexan-3-ol |
| SMILES | CC[C@H](N)C(O)CCN |
| InChI | InChI=1S/C6H16N2O/c1-2-5(8)6(9)3-4-7/h5-6,9H,2-4,7-8H2,1H3/t5-,6?/m0/s1 |
| InChIKey | XYAPDTVCPSZIQO-ZBHICJROSA-N |
| XLogP | -0.57 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-1,4-diaminohexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1,4-diaminohexan-3-ol?
The IUPAC name of (4S)-1,4-diaminohexan-3-ol (CID 149307886) is (4S)-1,4-diaminohexan-3-ol.
What is the SMILES notation for (4S)-1,4-diaminohexan-3-ol?
The canonical SMILES for (4S)-1,4-diaminohexan-3-ol is CC[C@H](N)C(O)CCN.
What is the InChIKey of (4S)-1,4-diaminohexan-3-ol?
The InChIKey is XYAPDTVCPSZIQO-ZBHICJROSA-N. The full InChI is InChI=1S/C6H16N2O/c1-2-5(8)6(9)3-4-7/h5-6,9H,2-4,7-8H2,1H3/t5-,6?/m0/s1.
What are the key properties of (4S)-1,4-diaminohexan-3-ol?
(4S)-1,4-diaminohexan-3-ol has a molecular weight of 132.21 g/mol, XLogP of -0.57, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1,4-diaminohexan-3-ol is sourced from PubChem (CID 149307886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).