C6H16N2O2 — CID 57132033
1,2-diaminohexane-3,4-diol (PubChem CID 57132033) has the molecular formula C6H16N2O2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1,2-diaminohexane-3,4-diol.
| Compound Name | 1,2-diaminohexane-3,4-diol |
|---|---|
| PubChem CID | 57132033 |
| Molecular Formula | C6H16N2O2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.12 |
| IUPAC Name | 1,2-diaminohexane-3,4-diol |
| SMILES | CCC(O)C(O)C(N)CN |
| InChI | InChI=1S/C6H16N2O2/c1-2-5(9)6(10)4(8)3-7/h4-6,9-10H,2-3,7-8H2,1H3 |
| InChIKey | KDSWDIFJRKUFJA-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |