C7H16O4 — CID 118099468
(2S,3R,4S,5R)-heptane-2,3,4,5-tetrol (PubChem CID 118099468) has the molecular formula C7H16O4 and a molecular weight of 164.20 g/mol. Its IUPAC name is (2S,3R,4S,5R)-heptane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R)-heptane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 118099468 |
| Molecular Formula | C7H16O4 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | (2S,3R,4S,5R)-heptane-2,3,4,5-tetrol |
| SMILES | CC[C@@H](O)[C@H](O)[C@H](O)[C@H](C)O |
| InChI | InChI=1S/C7H16O4/c1-3-5(9)7(11)6(10)4(2)8/h4-11H,3H2,1-2H3/t4-,5+,6+,7-/m0/s1 |
| InChIKey | GMWNLIZILPTDLU-WNJXEPBRSA-N |
| XLogP | -1.14 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |