C11H24O3 — CID 10488429
(3R,4S,6R,7R)-4,6-dimethylnonane-3,5,7-triol (PubChem CID 10488429) has the molecular formula C11H24O3 and a molecular weight of 204.31 g/mol. Its IUPAC name is (3R,4S,6R,7R)-4,6-dimethylnonane-3,5,7-triol.
| Compound Name | (3R,4S,6R,7R)-4,6-dimethylnonane-3,5,7-triol |
|---|---|
| PubChem CID | 10488429 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | (3R,4S,6R,7R)-4,6-dimethylnonane-3,5,7-triol |
| SMILES | CC[C@@H](O)[C@H](C)C(O)[C@H](C)[C@H](O)CC |
| InChI | InChI=1S/C11H24O3/c1-5-9(12)7(3)11(14)8(4)10(13)6-2/h7-14H,5-6H2,1-4H3/t7-,8+,9-,10-,11?/m1/s1 |
| InChIKey | XTJJEFGBVSUSHE-SJWJCTCFSA-N |
| XLogP | 1.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |