About magnesium;2-methylpentan-3-ol;dichloride
magnesium;2-methylpentan-3-ol;dichloride (PubChem CID 175030591) has the molecular formula C6H14Cl2MgO
and a molecular weight of 197.39 g/mol. Its IUPAC name is magnesium;2-methylpentan-3-ol;dichloride.
Molecular Properties
| Compound Name | magnesium;2-methylpentan-3-ol;dichloride |
| PubChem CID | 175030591 |
| Molecular Formula | C6H14Cl2MgO |
| Molecular Weight | 197.39 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | magnesium;2-methylpentan-3-ol;dichloride |
| SMILES | CCC(O)C(C)C.[Cl-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C6H14O.2ClH.Mg/c1-4-6(7)5(2)3;;;/h5-7H,4H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | KSKWJOBEUIMQFJ-UHFFFAOYSA-L |
| XLogP | -4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.39 |
| LogP ≤ 5 | -4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze magnesium;2-methylpentan-3-ol;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-methylpentan-3-ol;dichloride?
The IUPAC name of magnesium;2-methylpentan-3-ol;dichloride (CID 175030591) is magnesium;2-methylpentan-3-ol;dichloride.
What is the SMILES notation for magnesium;2-methylpentan-3-ol;dichloride?
The canonical SMILES for magnesium;2-methylpentan-3-ol;dichloride is CCC(O)C(C)C.[Cl-].[Cl-].[Mg+2].
What is the InChIKey of magnesium;2-methylpentan-3-ol;dichloride?
The InChIKey is KSKWJOBEUIMQFJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H14O.2ClH.Mg/c1-4-6(7)5(2)3;;;/h5-7H,4H2,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of magnesium;2-methylpentan-3-ol;dichloride?
magnesium;2-methylpentan-3-ol;dichloride has a molecular weight of 197.39 g/mol, XLogP of -4.96, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-methylpentan-3-ol;dichloride is sourced from PubChem (CID 175030591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).