C8H20O2 — CID 87383548
3-methylbutane-1,2-diol;propane (PubChem CID 87383548) has the molecular formula C8H20O2 and a molecular weight of 148.25 g/mol. Its IUPAC name is 3-methylbutane-1,2-diol;propane.
| Compound Name | 3-methylbutane-1,2-diol;propane |
|---|---|
| PubChem CID | 87383548 |
| Molecular Formula | C8H20O2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.15 |
| IUPAC Name | 3-methylbutane-1,2-diol;propane |
| SMILES | CC(C)C(O)CO.CCC |
| InChI | InChI=1S/C5H12O2.C3H8/c1-4(2)5(7)3-6;1-3-2/h4-7H,3H2,1-2H3;3H2,1-2H3 |
| InChIKey | KILQTAXNYNHOGW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |