C8H18O3 — CID 23384895
3-ethoxy-4-methylpentane-1,2-diol (PubChem CID 23384895) has the molecular formula C8H18O3 and a molecular weight of 162.23 g/mol. Its IUPAC name is 3-ethoxy-4-methylpentane-1,2-diol.
| Compound Name | 3-ethoxy-4-methylpentane-1,2-diol |
|---|---|
| PubChem CID | 23384895 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | 3-ethoxy-4-methylpentane-1,2-diol |
| SMILES | CCOC(C(C)C)C(O)CO |
| InChI | InChI=1S/C8H18O3/c1-4-11-8(6(2)3)7(10)5-9/h6-10H,4-5H2,1-3H3 |
| InChIKey | PFWLFUYDQJFLNJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |