C12H26O4 — CID 121007003
1,1,2,3-tetraethoxybutane (PubChem CID 121007003) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1,1,2,3-tetraethoxybutane.
| Compound Name | 1,1,2,3-tetraethoxybutane |
|---|---|
| PubChem CID | 121007003 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1,1,2,3-tetraethoxybutane |
| SMILES | CCOC(C)C(OCC)C(OCC)OCC |
| InChI | InChI=1S/C12H26O4/c1-6-13-10(5)11(14-7-2)12(15-8-3)16-9-4/h10-12H,6-9H2,1-5H3 |
| InChIKey | YHEFLJJJTUGJEU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|