C11H24O — CID 142521476
(2R,3R,4R)-2-ethoxy-3,4,5-trimethylhexane (PubChem CID 142521476) has the molecular formula C11H24O and a molecular weight of 172.31 g/mol. Its IUPAC name is (2R,3R,4R)-2-ethoxy-3,4,5-trimethylhexane.
| Compound Name | (2R,3R,4R)-2-ethoxy-3,4,5-trimethylhexane |
|---|---|
| PubChem CID | 142521476 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | (2R,3R,4R)-2-ethoxy-3,4,5-trimethylhexane |
| SMILES | CCO[C@H](C)[C@H](C)[C@H](C)C(C)C |
| InChI | InChI=1S/C11H24O/c1-7-12-11(6)10(5)9(4)8(2)3/h8-11H,7H2,1-6H3/t9-,10-,11-/m1/s1 |
| InChIKey | NHRAWGXPGRALJH-GMTAPVOTSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |