C10H22O — CID 123147502
2-methoxy-3,4,5-trimethylhexane (PubChem CID 123147502) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is 2-methoxy-3,4,5-trimethylhexane.
| Compound Name | 2-methoxy-3,4,5-trimethylhexane |
|---|---|
| PubChem CID | 123147502 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | 2-methoxy-3,4,5-trimethylhexane |
| SMILES | COC(C)C(C)C(C)C(C)C |
| InChI | InChI=1S/C10H22O/c1-7(2)8(3)9(4)10(5)11-6/h7-10H,1-6H3 |
| InChIKey | XYPQHWWUKNZRBW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |