C58H122 — CID 160593836
2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28-heptacosamethylnonacosane;methane (PubChem CID 160593836) has the molecular formula C58H122 and a molecular weight of 819.61 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28-heptacosamethylnonacosane;methane.
| Compound Name | 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28-heptacosamethylnonacosane;methane |
|---|---|
| PubChem CID | 160593836 |
| Molecular Formula | C58H122 |
| Molecular Weight | 819.61 g/mol |
| Exact Mass | 818.95 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28-heptacosamethylnonacosane;methane |
| SMILES | C.C.CC(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C |
| InChI | InChI=1S/C56H114.2CH4/c1-30(2)32(5)34(7)36(9)38(11)40(13)42(15)44(17)46(19)48(21)50(23)52(25)54(27)56(29)55(28)53(26)51(24)49(22)47(20)45(18)43(16)41(14)39(12)37(10)35(8)33(6)31(3)4;;/h30-56H,1-29H3;2*1H4 |
| InChIKey | RDJHLDHLCNUNIL-UHFFFAOYSA-N |
| XLogP | 19.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.61 |
| LogP ≤ 5 | 19.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |