C26H52 — CID 123523398
1-(3,4-dimethylpentan-2-yl)-2-(3,4,5,6,7,8-hexamethylnonan-2-yl)-3-methylcyclopropane (PubChem CID 123523398) has the molecular formula C26H52 and a molecular weight of 364.70 g/mol. Its IUPAC name is 1-(3,4-dimethylpentan-2-yl)-2-(3,4,5,6,7,8-hexamethylnonan-2-yl)-3-methylcyclopropane.
| Compound Name | 1-(3,4-dimethylpentan-2-yl)-2-(3,4,5,6,7,8-hexamethylnonan-2-yl)-3-methylcyclopropane |
|---|---|
| PubChem CID | 123523398 |
| Molecular Formula | C26H52 |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 364.41 |
| IUPAC Name | 1-(3,4-dimethylpentan-2-yl)-2-(3,4,5,6,7,8-hexamethylnonan-2-yl)-3-methylcyclopropane |
| SMILES | CC(C)C(C)C(C)C(C)C(C)C(C)C(C)C1C(C)C1C(C)C(C)C(C)C |
| InChI | InChI=1S/C26H52/c1-14(2)16(5)18(7)19(8)20(9)21(10)23(12)26-24(13)25(26)22(11)17(6)15(3)4/h14-26H,1-13H3 |
| InChIKey | CKXPJGVFQIOQTL-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |