About 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane
2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane (PubChem CID 123864307) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane.
Molecular Properties
| Compound Name | 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane |
| PubChem CID | 123864307 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane |
| SMILES | CC(C)C(C)C(C)C1C(C)CC(C)C1C |
| InChI | InChI=1S/C15H30/c1-9(2)12(5)14(7)15-11(4)8-10(3)13(15)6/h9-15H,8H2,1-7H3 |
| InChIKey | FUDOZLNOOFHBHK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane?
The IUPAC name of 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane (CID 123864307) is 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane.
What is the SMILES notation for 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane?
The canonical SMILES for 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane is CC(C)C(C)C(C)C1C(C)CC(C)C1C.
What is the InChIKey of 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane?
The InChIKey is FUDOZLNOOFHBHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30/c1-9(2)12(5)14(7)15-11(4)8-10(3)13(15)6/h9-15H,8H2,1-7H3.
What are the key properties of 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane?
2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane has a molecular weight of 210.40 g/mol, XLogP of 4.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylpentan-2-yl)-1,3,4-trimethylcyclopentane is sourced from PubChem (CID 123864307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).