C10H21Y72- — CID 163562736
carbanide;(1S,2S,3R,4R)-1,2,3,4-tetramethylcyclopentane;(yttrium) (PubChem CID 163562736) has the molecular formula C10H21Y72- and a molecular weight of 6542.51 g/mol. Its IUPAC name is carbanide;(1S,2S,3R,4R)-1,2,3,4-tetramethylcyclopentane;(yttrium).
| Compound Name | carbanide;(1S,2S,3R,4R)-1,2,3,4-tetramethylcyclopentane;(yttrium) |
|---|---|
| PubChem CID | 163562736 |
| Molecular Formula | C10H21Y72- |
| Molecular Weight | 6542.51 g/mol |
| Exact Mass | 6542.39 |
| IUPAC Name | carbanide;(1S,2S,3R,4R)-1,2,3,4-tetramethylcyclopentane;(yttrium) |
| SMILES | C[C@@H]1[C@H](C)[C@H](C)C[C@@H]1C.[CH3-].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C9H18.CH3.72Y/c1-6-5-7(2)9(4)8(6)3;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;/h6-9H,5H2,1-4H3;1H3;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;/q;-1;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;/t6-,7+,8-,9+;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;; |
| InChIKey | CPVHFZQXYCTMME-UWERQJKTSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 82 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 6542.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|