C9H19N — CID 130371803
3,4,5-trimethylcyclohexan-1-amine (PubChem CID 130371803) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is 3,4,5-trimethylcyclohexan-1-amine.
| Compound Name | 3,4,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 130371803 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 3,4,5-trimethylcyclohexan-1-amine |
| SMILES | CC1CC(N)CC(C)C1C |
| InChI | InChI=1S/C9H19N/c1-6-4-9(10)5-7(2)8(6)3/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | DIIKAFLFAPCSPD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |