About cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride
cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride (PubChem CID 146012745) has the molecular formula C4H10ClN
and a molecular weight of 107.58 g/mol. Its IUPAC name is cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride.
Analyze cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride?
The IUPAC name of cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride (CID 146012745) is cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride.
What is the SMILES notation for cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride?
The canonical SMILES for cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride is C[C@@H]1C[C@@H]1N.Cl.
What is the InChIKey of cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride?
The InChIKey is DGEKNIYQAIAEGO-HJXLNUONSA-N. The full InChI is InChI=1S/C4H9N.ClH/c1-3-2-4(3)5;/h3-4H,2,5H2,1H3;1H/t3-,4+;/m1./s1.
What are the key properties of cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride?
cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride has a molecular weight of 107.58 g/mol, XLogP of 0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-methylcyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 146012745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).