C8H17N — CID 15306003
(1S,2R,5R)-2,5-dimethylcyclohexan-1-amine (PubChem CID 15306003) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is (1S,2R,5R)-2,5-dimethylcyclohexan-1-amine.
| Compound Name | (1S,2R,5R)-2,5-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 15306003 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (1S,2R,5R)-2,5-dimethylcyclohexan-1-amine |
| SMILES | C[C@@H]1CC[C@@H](C)[C@@H](N)C1 |
| InChI | InChI=1S/C8H17N/c1-6-3-4-7(2)8(9)5-6/h6-8H,3-5,9H2,1-2H3/t6-,7-,8+/m1/s1 |
| InChIKey | JDDGZKNTHGVZTQ-PRJMDXOYSA-N |
| XLogP | 1.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |