C8H18BrN — CID 17138988
2,5-dimethylcyclohexan-1-amine;hydrobromide (PubChem CID 17138988) has the molecular formula C8H18BrN and a molecular weight of 208.14 g/mol. Its IUPAC name is 2,5-dimethylcyclohexan-1-amine;hydrobromide.
| Compound Name | 2,5-dimethylcyclohexan-1-amine;hydrobromide |
|---|---|
| PubChem CID | 17138988 |
| Molecular Formula | C8H18BrN |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2,5-dimethylcyclohexan-1-amine;hydrobromide |
| SMILES | Br.CC1CCC(C)C(N)C1 |
| InChI | InChI=1S/C8H17N.BrH/c1-6-3-4-7(2)8(9)5-6;/h6-8H,3-5,9H2,1-2H3;1H |
| InChIKey | CEDUJFWNRPRCKE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |