C7H18N2O4S — CID 11528700
4-methylcyclohexane-1,2-diamine;sulfuric acid (PubChem CID 11528700) has the molecular formula C7H18N2O4S and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-methylcyclohexane-1,2-diamine;sulfuric acid.
| Compound Name | 4-methylcyclohexane-1,2-diamine;sulfuric acid |
|---|---|
| PubChem CID | 11528700 |
| Molecular Formula | C7H18N2O4S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-methylcyclohexane-1,2-diamine;sulfuric acid |
| SMILES | CC1CCC(N)C(N)C1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H16N2.H2O4S/c1-5-2-3-6(8)7(9)4-5;1-5(2,3)4/h5-7H,2-4,8-9H2,1H3;(H2,1,2,3,4) |
| InChIKey | BHMDZNDALVDBAR-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|