C8H17NO — CID 13425492
2-amino-4,5-dimethylcyclohexan-1-ol (PubChem CID 13425492) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-amino-4,5-dimethylcyclohexan-1-ol.
| Compound Name | 2-amino-4,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 13425492 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-amino-4,5-dimethylcyclohexan-1-ol |
| SMILES | CC1CC(N)C(O)CC1C |
| InChI | InChI=1S/C8H17NO/c1-5-3-7(9)8(10)4-6(5)2/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | ALQOCHJHOKPYMP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |