About 4,5-dimethylcyclohexane-1,2-diol
4,5-dimethylcyclohexane-1,2-diol (PubChem CID 13429582) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 4,5-dimethylcyclohexane-1,2-diol.
Molecular Properties
| Compound Name | 4,5-dimethylcyclohexane-1,2-diol |
| PubChem CID | 13429582 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 4,5-dimethylcyclohexane-1,2-diol |
| SMILES | CC1CC(O)C(O)CC1C |
| InChI | InChI=1S/C8H16O2/c1-5-3-7(9)8(10)4-6(5)2/h5-10H,3-4H2,1-2H3 |
| InChIKey | OTVUTURDABHMCC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethylcyclohexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethylcyclohexane-1,2-diol?
The IUPAC name of 4,5-dimethylcyclohexane-1,2-diol (CID 13429582) is 4,5-dimethylcyclohexane-1,2-diol.
What is the SMILES notation for 4,5-dimethylcyclohexane-1,2-diol?
The canonical SMILES for 4,5-dimethylcyclohexane-1,2-diol is CC1CC(O)C(O)CC1C.
What is the InChIKey of 4,5-dimethylcyclohexane-1,2-diol?
The InChIKey is OTVUTURDABHMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-5-3-7(9)8(10)4-6(5)2/h5-10H,3-4H2,1-2H3.
What are the key properties of 4,5-dimethylcyclohexane-1,2-diol?
4,5-dimethylcyclohexane-1,2-diol has a molecular weight of 144.21 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethylcyclohexane-1,2-diol is sourced from PubChem (CID 13429582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).