About trans-(1R,2R)-cyclopropane-1,2-diol
trans-(1R,2R)-cyclopropane-1,2-diol (PubChem CID 59075452) has the molecular formula C3H6O2
and a molecular weight of 74.08 g/mol. Its IUPAC name is trans-(1R,2R)-cyclopropane-1,2-diol.
Molecular Properties
| Compound Name | trans-(1R,2R)-cyclopropane-1,2-diol |
| PubChem CID | 59075452 |
| Molecular Formula | C3H6O2 |
| Molecular Weight | 74.08 g/mol |
| Exact Mass | 74.04 |
| IUPAC Name | trans-(1R,2R)-cyclopropane-1,2-diol |
| SMILES | O[C@@H]1C[C@H]1O |
| InChI | InChI=1S/C3H6O2/c4-2-1-3(2)5/h2-5H,1H2/t2-,3-/m1/s1 |
| InChIKey | BTWIMZVCLMHNAV-PWNYCUMCSA-N |
| XLogP | -0.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 74.08 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-cyclopropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-cyclopropane-1,2-diol?
The IUPAC name of trans-(1R,2R)-cyclopropane-1,2-diol (CID 59075452) is trans-(1R,2R)-cyclopropane-1,2-diol.
What is the SMILES notation for trans-(1R,2R)-cyclopropane-1,2-diol?
The canonical SMILES for trans-(1R,2R)-cyclopropane-1,2-diol is O[C@@H]1C[C@H]1O.
What is the InChIKey of trans-(1R,2R)-cyclopropane-1,2-diol?
The InChIKey is BTWIMZVCLMHNAV-PWNYCUMCSA-N. The full InChI is InChI=1S/C3H6O2/c4-2-1-3(2)5/h2-5H,1H2/t2-,3-/m1/s1.
What are the key properties of trans-(1R,2R)-cyclopropane-1,2-diol?
trans-(1R,2R)-cyclopropane-1,2-diol has a molecular weight of 74.08 g/mol, XLogP of -0.89, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-cyclopropane-1,2-diol is sourced from PubChem (CID 59075452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).