C5H10O3S — CID 13309262
(4S,5S)-thiane-2,4,5-triol (PubChem CID 13309262) has the molecular formula C5H10O3S and a molecular weight of 150.20 g/mol. Its IUPAC name is (4S,5S)-thiane-2,4,5-triol.
| Compound Name | (4S,5S)-thiane-2,4,5-triol |
|---|---|
| PubChem CID | 13309262 |
| Molecular Formula | C5H10O3S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | (4S,5S)-thiane-2,4,5-triol |
| SMILES | OC1C[C@H](O)[C@H](O)CS1 |
| InChI | InChI=1S/C5H10O3S/c6-3-1-5(8)9-2-4(3)7/h3-8H,1-2H2/t3-,4+,5?/m0/s1 |
| InChIKey | ULAILZANWDXJIK-PYHARJCCSA-N |
| XLogP | -0.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |