C6H12O4S — CID 130404269
(2S,3R,4S)-2-[(1R)-1,2-dihydroxyethyl]thiolane-3,4-diol (PubChem CID 130404269) has the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. Its IUPAC name is (2S,3R,4S)-2-[(1R)-1,2-dihydroxyethyl]thiolane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-[(1R)-1,2-dihydroxyethyl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 130404269 |
| Molecular Formula | C6H12O4S |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (2S,3R,4S)-2-[(1R)-1,2-dihydroxyethyl]thiolane-3,4-diol |
| SMILES | OC[C@@H](O)[C@@H]1SC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O4S/c7-1-3(8)6-5(10)4(9)2-11-6/h3-10H,1-2H2/t3-,4-,5-,6+/m1/s1 |
| InChIKey | YCHDTHHGHDMALK-KAZBKCHUSA-N |
| XLogP | -1.82 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |