About 1-(thian-4-yl)ethane-1,2-diol
1-(thian-4-yl)ethane-1,2-diol (PubChem CID 117238988) has the molecular formula C7H14O2S
and a molecular weight of 162.25 g/mol. Its IUPAC name is 1-(thian-4-yl)ethane-1,2-diol.
Molecular Properties
| Compound Name | 1-(thian-4-yl)ethane-1,2-diol |
| PubChem CID | 117238988 |
| Molecular Formula | C7H14O2S |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 1-(thian-4-yl)ethane-1,2-diol |
| SMILES | OCC(O)C1CCSCC1 |
| InChI | InChI=1S/C7H14O2S/c8-5-7(9)6-1-3-10-4-2-6/h6-9H,1-5H2 |
| InChIKey | QIJUHPCRTSJAHI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(thian-4-yl)ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(thian-4-yl)ethane-1,2-diol?
The IUPAC name of 1-(thian-4-yl)ethane-1,2-diol (CID 117238988) is 1-(thian-4-yl)ethane-1,2-diol.
What is the SMILES notation for 1-(thian-4-yl)ethane-1,2-diol?
The canonical SMILES for 1-(thian-4-yl)ethane-1,2-diol is OCC(O)C1CCSCC1.
What is the InChIKey of 1-(thian-4-yl)ethane-1,2-diol?
The InChIKey is QIJUHPCRTSJAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2S/c8-5-7(9)6-1-3-10-4-2-6/h6-9H,1-5H2.
What are the key properties of 1-(thian-4-yl)ethane-1,2-diol?
1-(thian-4-yl)ethane-1,2-diol has a molecular weight of 162.25 g/mol, XLogP of 0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(thian-4-yl)ethane-1,2-diol is sourced from PubChem (CID 117238988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).