C8H17NO2 — CID 143640316
(1S)-1-(1-methylpiperidin-4-yl)ethane-1,2-diol (PubChem CID 143640316) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (1S)-1-(1-methylpiperidin-4-yl)ethane-1,2-diol.
| Compound Name | (1S)-1-(1-methylpiperidin-4-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 143640316 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (1S)-1-(1-methylpiperidin-4-yl)ethane-1,2-diol |
| SMILES | CN1CCC([C@H](O)CO)CC1 |
| InChI | InChI=1S/C8H17NO2/c1-9-4-2-7(3-5-9)8(11)6-10/h7-8,10-11H,2-6H2,1H3/t8-/m1/s1 |
| InChIKey | QEIYCPAPYXUGTN-MRVPVSSYSA-N |
| XLogP | -0.32 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |