C11H22O3 — CID 58100174
1-[3-(1-hydroxypropyl)cyclohexyl]ethane-1,2-diol (PubChem CID 58100174) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 1-[3-(1-hydroxypropyl)cyclohexyl]ethane-1,2-diol.
| Compound Name | 1-[3-(1-hydroxypropyl)cyclohexyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 58100174 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 1-[3-(1-hydroxypropyl)cyclohexyl]ethane-1,2-diol |
| SMILES | CCC(O)C1CCCC(C(O)CO)C1 |
| InChI | InChI=1S/C11H22O3/c1-2-10(13)8-4-3-5-9(6-8)11(14)7-12/h8-14H,2-7H2,1H3 |
| InChIKey | JVWKGAULELTJCB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |