About (1R)-1-cyclopentylpropan-1-ol;sulfane
(1R)-1-cyclopentylpropan-1-ol;sulfane (PubChem CID 161153256) has the molecular formula C8H20OS2
and a molecular weight of 196.38 g/mol. Its IUPAC name is (1R)-1-cyclopentylpropan-1-ol;sulfane.
Molecular Properties
| Compound Name | (1R)-1-cyclopentylpropan-1-ol;sulfane |
| PubChem CID | 161153256 |
| Molecular Formula | C8H20OS2 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (1R)-1-cyclopentylpropan-1-ol;sulfane |
| SMILES | CC[C@@H](O)C1CCCC1.S.S |
| InChI | InChI=1S/C8H16O.2H2S/c1-2-8(9)7-5-3-4-6-7;;/h7-9H,2-6H2,1H3;2*1H2/t8-;;/m1../s1 |
| InChIKey | UOYQCKSQHPBDLI-YCBDHFTFSA-N |
| XLogP | 2.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-cyclopentylpropan-1-ol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-cyclopentylpropan-1-ol;sulfane?
The IUPAC name of (1R)-1-cyclopentylpropan-1-ol;sulfane (CID 161153256) is (1R)-1-cyclopentylpropan-1-ol;sulfane.
What is the SMILES notation for (1R)-1-cyclopentylpropan-1-ol;sulfane?
The canonical SMILES for (1R)-1-cyclopentylpropan-1-ol;sulfane is CC[C@@H](O)C1CCCC1.S.S.
What is the InChIKey of (1R)-1-cyclopentylpropan-1-ol;sulfane?
The InChIKey is UOYQCKSQHPBDLI-YCBDHFTFSA-N. The full InChI is InChI=1S/C8H16O.2H2S/c1-2-8(9)7-5-3-4-6-7;;/h7-9H,2-6H2,1H3;2*1H2/t8-;;/m1../s1.
What are the key properties of (1R)-1-cyclopentylpropan-1-ol;sulfane?
(1R)-1-cyclopentylpropan-1-ol;sulfane has a molecular weight of 196.38 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-cyclopentylpropan-1-ol;sulfane is sourced from PubChem (CID 161153256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).