C12H22O — CID 159001079
(1R)-1-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]propan-1-ol (PubChem CID 159001079) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (1R)-1-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]propan-1-ol.
| Compound Name | (1R)-1-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 159001079 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (1R)-1-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]propan-1-ol |
| SMILES | CC[C@@H](O)C1C[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C12H22O/c1-2-12(13)11-7-9-5-3-4-6-10(9)8-11/h9-13H,2-8H2,1H3/t9-,10+,11?,12-/m1/s1 |
| InChIKey | QPPQCPZEURTJCJ-AYLPWXGPSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |