C20H36FNO — CID 140698802
(1S,2R)-2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2-fluorocyclohexyl)-3-(methylamino)propan-1-ol (PubChem CID 140698802) has the molecular formula C20H36FNO and a molecular weight of 325.51 g/mol. Its IUPAC name is (1S,2R)-2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2-fluorocyclohexyl)-3-(methylamino)propan-1-ol.
| Compound Name | (1S,2R)-2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2-fluorocyclohexyl)-3-(methylamino)propan-1-ol |
|---|---|
| PubChem CID | 140698802 |
| Molecular Formula | C20H36FNO |
| Molecular Weight | 325.51 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | (1S,2R)-2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1-(2-fluorocyclohexyl)-3-(methylamino)propan-1-ol |
| SMILES | CNC[C@@H](C1CCC2CCCCC2C1)[C@H](O)C1CCCCC1F |
| InChI | InChI=1S/C20H36FNO/c1-22-13-18(20(23)17-8-4-5-9-19(17)21)16-11-10-14-6-2-3-7-15(14)12-16/h14-20,22-23H,2-13H2,1H3/t14?,15?,16?,17?,18-,19?,20+/m0/s1 |
| InChIKey | LTBNFCWNEMLDOT-GFWDSOMCSA-N |
| XLogP | 4.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |