C8H17NO4S — CID 115034054
2-hydroxy-2-(1-methylpiperidin-4-yl)ethanesulfonic acid (PubChem CID 115034054) has the molecular formula C8H17NO4S and a molecular weight of 223.29 g/mol. Its IUPAC name is 2-hydroxy-2-(1-methylpiperidin-4-yl)ethanesulfonic acid.
| Compound Name | 2-hydroxy-2-(1-methylpiperidin-4-yl)ethanesulfonic acid |
|---|---|
| PubChem CID | 115034054 |
| Molecular Formula | C8H17NO4S |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-hydroxy-2-(1-methylpiperidin-4-yl)ethanesulfonic acid |
| SMILES | CN1CCC(C(O)CS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C8H17NO4S/c1-9-4-2-7(3-5-9)8(10)6-14(11,12)13/h7-8,10H,2-6H2,1H3,(H,11,12,13) |
| InChIKey | MBHYVGNNVAPWMT-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|