About CID 140659607
CID 140659607 (PubChem CID 140659607) has the molecular formula C7H13OS
and a molecular weight of 145.25 g/mol.
Molecular Properties
| Compound Name | CID 140659607 |
| PubChem CID | 140659607 |
| Molecular Formula | C7H13OS |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | — |
| SMILES | [CH2]C(O)C1CCSCC1 |
| InChI | InChI=1S/C7H13OS/c1-6(8)7-2-4-9-5-3-7/h6-8H,1-5H2 |
| InChIKey | FIAIMTHHZZZSFN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 140659607 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140659607?
The IUPAC name of CID 140659607 (CID 140659607) is not available.
What is the SMILES notation for CID 140659607?
The canonical SMILES for CID 140659607 is [CH2]C(O)C1CCSCC1.
What is the InChIKey of CID 140659607?
The InChIKey is FIAIMTHHZZZSFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13OS/c1-6(8)7-2-4-9-5-3-7/h6-8H,1-5H2.
What are the key properties of CID 140659607?
CID 140659607 has a molecular weight of 145.25 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140659607 is sourced from PubChem (CID 140659607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).