About 2-(thian-4-yl)propanal
2-(thian-4-yl)propanal (PubChem CID 83905312) has the molecular formula C8H14OS
and a molecular weight of 158.27 g/mol. Its IUPAC name is 2-(thian-4-yl)propanal.
Molecular Properties
| Compound Name | 2-(thian-4-yl)propanal |
| PubChem CID | 83905312 |
| Molecular Formula | C8H14OS |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 2-(thian-4-yl)propanal |
| SMILES | CC(C=O)C1CCSCC1 |
| InChI | InChI=1S/C8H14OS/c1-7(6-9)8-2-4-10-5-3-8/h6-8H,2-5H2,1H3 |
| InChIKey | JXMQILVDLKWWOC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(thian-4-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thian-4-yl)propanal?
The IUPAC name of 2-(thian-4-yl)propanal (CID 83905312) is 2-(thian-4-yl)propanal.
What is the SMILES notation for 2-(thian-4-yl)propanal?
The canonical SMILES for 2-(thian-4-yl)propanal is CC(C=O)C1CCSCC1.
What is the InChIKey of 2-(thian-4-yl)propanal?
The InChIKey is JXMQILVDLKWWOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14OS/c1-7(6-9)8-2-4-10-5-3-8/h6-8H,2-5H2,1H3.
What are the key properties of 2-(thian-4-yl)propanal?
2-(thian-4-yl)propanal has a molecular weight of 158.27 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thian-4-yl)propanal is sourced from PubChem (CID 83905312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).