About cyclopropane;2-cyclopropylpropanal;2-methyloxirane
cyclopropane;2-cyclopropylpropanal;2-methyloxirane (PubChem CID 174820303) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is cyclopropane;2-cyclopropylpropanal;2-methyloxirane.
Molecular Properties
| Compound Name | cyclopropane;2-cyclopropylpropanal;2-methyloxirane |
| PubChem CID | 174820303 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | cyclopropane;2-cyclopropylpropanal;2-methyloxirane |
| SMILES | C1CC1.CC(C=O)C1CC1.CC1CO1 |
| InChI | InChI=1S/C6H10O.C3H6O.C3H6/c1-5(4-7)6-2-3-6;1-3-2-4-3;1-2-3-1/h4-6H,2-3H2,1H3;3H,2H2,1H3;1-3H2 |
| InChIKey | SSAMTTAMZUUOEH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;2-cyclopropylpropanal;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;2-cyclopropylpropanal;2-methyloxirane?
The IUPAC name of cyclopropane;2-cyclopropylpropanal;2-methyloxirane (CID 174820303) is cyclopropane;2-cyclopropylpropanal;2-methyloxirane.
What is the SMILES notation for cyclopropane;2-cyclopropylpropanal;2-methyloxirane?
The canonical SMILES for cyclopropane;2-cyclopropylpropanal;2-methyloxirane is C1CC1.CC(C=O)C1CC1.CC1CO1.
What is the InChIKey of cyclopropane;2-cyclopropylpropanal;2-methyloxirane?
The InChIKey is SSAMTTAMZUUOEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C3H6O.C3H6/c1-5(4-7)6-2-3-6;1-3-2-4-3;1-2-3-1/h4-6H,2-3H2,1H3;3H,2H2,1H3;1-3H2.
What are the key properties of cyclopropane;2-cyclopropylpropanal;2-methyloxirane?
cyclopropane;2-cyclopropylpropanal;2-methyloxirane has a molecular weight of 198.31 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;2-cyclopropylpropanal;2-methyloxirane is sourced from PubChem (CID 174820303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).