C6H12O3S — CID 130152138
2-(hydroxymethyl)thiane-3,5-diol (PubChem CID 130152138) has the molecular formula C6H12O3S and a molecular weight of 164.23 g/mol. Its IUPAC name is 2-(hydroxymethyl)thiane-3,5-diol.
| Compound Name | 2-(hydroxymethyl)thiane-3,5-diol |
|---|---|
| PubChem CID | 130152138 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 2-(hydroxymethyl)thiane-3,5-diol |
| SMILES | OCC1SCC(O)CC1O |
| InChI | InChI=1S/C6H12O3S/c7-2-6-5(9)1-4(8)3-10-6/h4-9H,1-3H2 |
| InChIKey | FSDBZTPQPCBDAJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |