C8H16O2S — CID 143617465
2-(hydroxymethyl)-3,6-dimethylthian-4-ol (PubChem CID 143617465) has the molecular formula C8H16O2S and a molecular weight of 176.28 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,6-dimethylthian-4-ol.
| Compound Name | 2-(hydroxymethyl)-3,6-dimethylthian-4-ol |
|---|---|
| PubChem CID | 143617465 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-(hydroxymethyl)-3,6-dimethylthian-4-ol |
| SMILES | CC1CC(O)C(C)C(CO)S1 |
| InChI | InChI=1S/C8H16O2S/c1-5-3-7(10)6(2)8(4-9)11-5/h5-10H,3-4H2,1-2H3 |
| InChIKey | WCPKRCSZLJRWOF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |