C5H10O4S — CID 57056328
(2S,3S,4S,5S)-5-(hydroxymethyl)thiolane-2,3,4-triol (PubChem CID 57056328) has the molecular formula C5H10O4S and a molecular weight of 166.20 g/mol. Its IUPAC name is (2S,3S,4S,5S)-5-(hydroxymethyl)thiolane-2,3,4-triol.
| Compound Name | (2S,3S,4S,5S)-5-(hydroxymethyl)thiolane-2,3,4-triol |
|---|---|
| PubChem CID | 57056328 |
| Molecular Formula | C5H10O4S |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | (2S,3S,4S,5S)-5-(hydroxymethyl)thiolane-2,3,4-triol |
| SMILES | OC[C@@H]1S[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H10O4S/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3+,4-,5-/m0/s1 |
| InChIKey | YRSNDNVRKGEOHF-QTBDOELSSA-N |
| XLogP | -1.87 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |