C12H22O6S — CID 56985329
6-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]hexanoic acid (PubChem CID 56985329) has the molecular formula C12H22O6S and a molecular weight of 294.37 g/mol. Its IUPAC name is 6-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]hexanoic acid.
| Compound Name | 6-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 56985329 |
| Molecular Formula | C12H22O6S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 6-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]hexanoic acid |
| SMILES | O=C(O)CCCCC[C@H]1S[C@@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O6S/c13-6-8-11(17)12(18)10(16)7(19-8)4-2-1-3-5-9(14)15/h7-8,10-13,16-18H,1-6H2,(H,14,15)/t7-,8+,10+,11-,12-/m1/s1 |
| InChIKey | QAILAKPIHKWBRX-SWSUZQIZSA-N |
| XLogP | -0.42 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|