C8H15IO3S — CID 163826921
(2R,3S,4R)-2-(hydroxymethyl)-5-[(2S)-2-iodopropyl]thiolane-3,4-diol (PubChem CID 163826921) has the molecular formula C8H15IO3S and a molecular weight of 318.18 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-[(2S)-2-iodopropyl]thiolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[(2S)-2-iodopropyl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 163826921 |
| Molecular Formula | C8H15IO3S |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[(2S)-2-iodopropyl]thiolane-3,4-diol |
| SMILES | C[C@H](I)CC1S[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H15IO3S/c1-4(9)2-5-7(11)8(12)6(3-10)13-5/h4-8,10-12H,2-3H2,1H3/t4-,5?,6+,7-,8+/m0/s1 |
| InChIKey | OAGOZAIIAUBMRS-GRPDIJBLSA-N |
| XLogP | 0.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|