C9H18O8 — CID 25258192
(1S,2S,3S,5R,6S,7R)-8-(hydroxymethyl)cyclooctane-1,2,3,4,5,6,7-heptol (PubChem CID 25258192) has the molecular formula C9H18O8 and a molecular weight of 254.24 g/mol. Its IUPAC name is (1S,2S,3S,5R,6S,7R)-8-(hydroxymethyl)cyclooctane-1,2,3,4,5,6,7-heptol.
| Compound Name | (1S,2S,3S,5R,6S,7R)-8-(hydroxymethyl)cyclooctane-1,2,3,4,5,6,7-heptol |
|---|---|
| PubChem CID | 25258192 |
| Molecular Formula | C9H18O8 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (1S,2S,3S,5R,6S,7R)-8-(hydroxymethyl)cyclooctane-1,2,3,4,5,6,7-heptol |
| SMILES | OCC1[C@@H](O)[C@H](O)[C@@H](O)C(O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H18O8/c10-1-2-3(11)5(13)7(15)9(17)8(16)6(14)4(2)12/h2-17H,1H2/t2?,3-,4+,5+,6-,7-,8+,9? |
| InChIKey | YALOPTXVUSUZOF-SNYCBPTKSA-N |
| XLogP | -4.87 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |