C6H14ClNO4 — CID 11264099
[(1S,2R,3R,4S,5S)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]azanium chloride (PubChem CID 11264099) has the molecular formula C6H14ClNO4 and a molecular weight of 199.63 g/mol. Its IUPAC name is [(1S,2R,3R,4S,5S)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]azanium chloride.
| Compound Name | [(1S,2R,3R,4S,5S)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]azanium chloride |
|---|---|
| PubChem CID | 11264099 |
| Molecular Formula | C6H14ClNO4 |
| Molecular Weight | 199.63 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | [(1S,2R,3R,4S,5S)-2,3,5-trihydroxy-4-(hydroxymethyl)cyclopentyl]azanium chloride |
| SMILES | [Cl-].[NH3+][C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C6H13NO4.ClH/c7-3-4(9)2(1-8)5(10)6(3)11;/h2-6,8-11H,1,7H2;1H/t2-,3-,4-,5+,6+;/m0./s1 |
| InChIKey | BHXHHZVGWZHJNT-UIAMRETRSA-N |
| XLogP | -6.69 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.63 |
| LogP ≤ 5 | -6.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |