C6H18N3O3+3 — CID 21280594
[3,5-bis(azaniumyl)-2,4,6-trihydroxycyclohexyl]azanium (PubChem CID 21280594) has the molecular formula C6H18N3O3+3 and a molecular weight of 180.23 g/mol. Its IUPAC name is [3,5-bis(azaniumyl)-2,4,6-trihydroxycyclohexyl]azanium.
| Compound Name | [3,5-bis(azaniumyl)-2,4,6-trihydroxycyclohexyl]azanium |
|---|---|
| PubChem CID | 21280594 |
| Molecular Formula | C6H18N3O3+3 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | [3,5-bis(azaniumyl)-2,4,6-trihydroxycyclohexyl]azanium |
| SMILES | [NH3+]C1C(O)C([NH3+])C(O)C([NH3+])C1O |
| InChI | InChI=1S/C6H15N3O3/c7-1-4(10)2(8)6(12)3(9)5(1)11/h1-6,10-12H,7-9H2/p+3 |
| InChIKey | OKPBGFSFTUQDJP-UHFFFAOYSA-Q |
| XLogP | -6.09 |
| TPSA | 143.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | -6.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |