C6H16Cl2N2O — CID 11816534
[(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium dichloride (PubChem CID 11816534) has the molecular formula C6H16Cl2N2O and a molecular weight of 203.11 g/mol. Its IUPAC name is [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium dichloride.
| Compound Name | [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium dichloride |
|---|---|
| PubChem CID | 11816534 |
| Molecular Formula | C6H16Cl2N2O |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium dichloride |
| SMILES | [Cl-].[Cl-].[NH3+][C@H]1[C@H](O)CCC[C@@H]1[NH3+] |
| InChI | InChI=1S/C6H14N2O.2ClH/c7-4-2-1-3-5(9)6(4)8;;/h4-6,9H,1-3,7-8H2;2*1H/t4-,5+,6+;;/m0../s1 |
| InChIKey | PZCCLURFNZLXLF-FVALZTRZSA-N |
| XLogP | -8.24 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | -8.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |