C6H16Cl2N2 — CID 11788705
[(1S,2S)-2-azaniumylcyclohexyl]azanium dichloride (PubChem CID 11788705) has the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. Its IUPAC name is [(1S,2S)-2-azaniumylcyclohexyl]azanium dichloride.
| Compound Name | [(1S,2S)-2-azaniumylcyclohexyl]azanium dichloride |
|---|---|
| PubChem CID | 11788705 |
| Molecular Formula | C6H16Cl2N2 |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | [(1S,2S)-2-azaniumylcyclohexyl]azanium dichloride |
| SMILES | [Cl-].[Cl-].[NH3+][C@H]1CCCC[C@@H]1[NH3+] |
| InChI | InChI=1S/C6H14N2.2ClH/c7-5-3-1-2-4-6(5)8;;/h5-6H,1-4,7-8H2;2*1H/t5-,6-;;/m0../s1 |
| InChIKey | HEKOZXSZLOBKGM-USPAICOZSA-N |
| XLogP | -7.21 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | -7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |